| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
- PALONOSETRON HCL
-
- $7.00
-
2020-01-03
- CAS:135729-75-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | Palonosetron HCl Basic information |
| Product Name: | Palonosetron HCl | | Synonyms: | (R,R)-Palonosetron Hydrochloride;RS 25259-198;(3aR)-2-(3R)-1-Azabicyclo[2.2.2]oct-3-yl-2,3,3a,4,5,6-hexahydro-1H-benz[de]isoquinolin-1-one Hydrochloride;Palonosetron HydrochlorideEnantiomers (R.R);(R)-2-((R)-quinuclidin-3-yl)-2,3,3a,4,5,6-hexahydro-1H-benzo[de]isoquinolin-1-one hydrochloride;Palonosetron Entionmer;(R)-2-((R)-quinuclidin-3-yl)-2,3,3a,4,5,6-hexahydro-1H-benzo[de]isoquinolin-1-;Palonosetron (R,R)-Isomer | | CAS: | 135729-75-8 | | MF: | C19H24N2O | | MW: | 296.412 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 135729-75-8.mol |  |
| | Palonosetron HCl Chemical Properties |
| Melting point | 281-283°C (dec.) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H24N2O.ClH/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20;/h2,4,6,13,15,17H,1,3,5,7-12H2;1H/t15-,17-;/m0./s1 | | InChIKey | OLDRWYVIKMSFFB-NBLXOJGSSA-N | | SMILES | Cl.N21C[C@@H](C(CC2)CC1)N3C[C@@H]4CCCc5c4c(ccc5)C3=O |
| WGK Germany | WGK 3 | | HS Code | 2933790002 | | Storage Class | 11 - Combustible Solids |
| | Palonosetron HCl Usage And Synthesis |
| Chemical Properties | PALONOSETRON HCL is Off-White Solid | | Uses | Serotonin 5-HT3 receptor antagonist used in the prevention and treatment of chemotherapy-induced nausea and vomiting (CINV). Antiemetic. | | Uses | PALONOSETRON HCL is used in the prevention and treatment of chemotherapy-induced nausea and vomiting (CINV). Antiemetic. |
| | Palonosetron HCl Preparation Products And Raw materials |
|