- N-Heptafluorobutyrylimidazole
-
- $5.00 / 1KG
-
2025-09-25
- CAS:32477-35-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | N-Heptafluorobutyrylimidazole Basic information |
| | N-Heptafluorobutyrylimidazole Chemical Properties |
| Melting point | 9-13 °C | | Boiling point | 161 °C(lit.) | | density | 1.490 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.3865(lit.) | | Fp | 171 °F | | storage temp. | 2-8°C | | solubility | Miscible with chloroform and methanol. | | form | Oil | | pka | 1.37±0.10(Predicted) | | color | Pale Yellow | | Sensitive | Hygroscopic | | BRN | 4488026 | | Stability: | Moisture Sensitive | | InChI | 1S/C7H3F7N2O/c8-5(9,6(10,11)7(12,13)14)4(17)16-2-1-15-3-16/h1-3H | | InChIKey | MSYHGYDAVLDKCE-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)n1ccnc1 | | CAS DataBase Reference | 32477-35-3(CAS DataBase Reference) | | NIST Chemistry Reference | N-Heptafluorobutyrylimidazole(32477-35-3) | | EPA Substance Registry System | 1-(Heptafluorobutyryl)imidazole (32477-35-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | F | 3-10-21 | | Hazard Note | Irritant/Hygroscopic/Keep Cold | | HazardClass | IRRITANT, MOISTURE SENSITIVE, KEEP COLD | | HS Code | 29332900 | | Storage Class | 10 - Combustible liquids |
| | N-Heptafluorobutyrylimidazole Usage And Synthesis |
| Chemical Properties | N-Heptafluorobutyrylimidazole is colorless liquid | | Uses | 1-(Heptafluorobutyryl)imidazole is used in gas chromatography for the determination of various pharmaceutical compounds like retronecine in biological matrixes. It acts as a reagent for derivatize amine-groups. It plays an essential role to reduce GC column degradation due to its non-acidic property. It is an acylating agent, which converts thermally unstable compounds to its more volatile derivative and then made suitable for GC analysis. | | Uses | N-Heptafluorobutyrylimidazole is a derivatization agent used in gas chromatography for determination of various pharmaceutical compounds such as retronecine in biological matrixes. | | General Description | May form a precipitate and may darken on storage-will not effect performance. | | reaction suitability | reagent type: derivatization reagent
reaction type: Acylations | | Biochem/physiol Actions | Mild amine-group derivatizing reagent; non-acidic by-product prevents decomposition and reduces GC column degradation. |
| | N-Heptafluorobutyrylimidazole Preparation Products And Raw materials |
|