|
|
| | 2-C-Methyl-D-ribono-1,4-lactone Basic information |
| Product Name: | 2-C-Methyl-D-ribono-1,4-lactone | | Synonyms: | 3,4-Dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-one;(3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyldihydrofuran-2(3H)-one;2-C-Methyl-;2-C-Methyl-D-ribonoic-1,4-lactone;2-C-metylribono-γ-lactone;D-Ribonic acid, 2-C-methyl-, γ-lactone;3,4-dihydroxy-3-methyl-5-methylol-tetrahydrofuran-2-one;2-C-Methyl-D-ribonoicacid-1,4-Lactone | | CAS: | 492-30-8 | | MF: | C6H10O5 | | MW: | 162.14 | | EINECS: | 610-448-4 | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 492-30-8.mol |  |
| | 2-C-Methyl-D-ribono-1,4-lactone Chemical Properties |
| Melting point | 150-160°C | | Boiling point | 338.3±11.0 °C(Predicted) | | density | 1.512±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 12.12±0.60(Predicted) | | color | White to Off-White | | InChI | InChI=1/C6H10O5/c1-6(10)4(8)3(2-7)11-5(6)9/h3-4,7-8,10H,2H2,1H3/t3-,4-,6-/s3 | | InChIKey | WJBVKNHJSHYNHO-HEJOAXAENA-N | | SMILES | C([C@H]1OC(=O)[C@@](O)(C)[C@@H]1O)O |&1:1,5,8,r| |
| | 2-C-Methyl-D-ribono-1,4-lactone Usage And Synthesis |
| Chemical Properties | 2-C-Methyl-D-ribono-1,4-lactone is White to Off-White Solid | | Uses | 2-C-Methyl-D-ribono-1,4-lactone is used in synthesis of enantiomerically pure 4-substituted riboses; also for preparing saccharinic acids and lactones via Amadori rearrangement for use as synthons toward herbicidal esters and branched nucleosides. |
| | 2-C-Methyl-D-ribono-1,4-lactone Preparation Products And Raw materials |
|