|
| flufenacet-alcohol Basic information |
Product Name: | flufenacet-alcohol | Synonyms: | flufenacet-alcohol;flufenacet-hydroxy;Acetamide, N-(4-fluorophenyl)-2-hydroxy-N-(1-m ethylethyl)-;N-(4-fluorophenyl)-2-hydroxy-N-(1-methylethyl)acetamide;flufenacet-alcohol ISO 9001:2015 REACH;N-(4-fluorophenyl)-2-hydroxy-N-isopropylacetamide;N-(4-fluorophenyl)-2-hydroxy-N-propan-2-ylacetamide;4'-Fluoro-N-isopropyl-2-hydroxyacetanilide | CAS: | 54041-17-7 | MF: | C11H14FNO2 | MW: | 211.23 | EINECS: | 611-084-9 | Product Categories: | | Mol File: | 54041-17-7.mol |  |
| flufenacet-alcohol Chemical Properties |
Boiling point | 323.8±27.0 °C(Predicted) | density | 1.199±0.06 g/cm3(Predicted) | vapor pressure | 0.083-0.522Pa at 20-50℃ | form | Solid | pka | 12.97±0.10(Predicted) | InChI | InChI=1S/C11H14FNO2/c1-8(2)13(11(15)7-14)10-5-3-9(12)4-6-10/h3-6,8,14H,7H2,1-2H3 | InChIKey | RISGISSUGUGJMO-UHFFFAOYSA-N | SMILES | C(N(C1=CC=C(F)C=C1)C(C)C)(=O)CO | LogP | 1.6 at 30℃ and pH6-8 | Surface tension | 58mN/m at 1.001g/L and 20℃ | EPA Substance Registry System | Acetamide, N-(4-fluorophenyl)-2-hydroxy-N-(1-methylethyl)- (54041-17-7) |
| flufenacet-alcohol Usage And Synthesis |
Uses | Flufenacet Alcohol can be used as herbicides. |
| flufenacet-alcohol Preparation Products And Raw materials |
|