|
|
| | 3,5-DI-TERT-BUTYLANILINE Basic information |
| Product Name: | 3,5-DI-TERT-BUTYLANILINE | | Synonyms: | 3,5-DI-TERT-BUTYLANILINE;AKOS BC-0700;3,5-Bis(1,1-dimethylethyl)-1-benzenamine;(3,5-ditert-butylphenyl)amine;2,3-detert-butylaniline;3,5-Bis(tert-butyl)aniline;BENZENAMINE, 3,5-BIS(1,1-DIMETHYLETHYL)-;3,5-Di-tert-butylaniline 98% | | CAS: | 2380-36-1 | | MF: | C14H23N | | MW: | 205.34 | | EINECS: | 219-173-0 | | Product Categories: | Anilines, Aromatic Amines and Nitro Compounds;Aromatic Hydrocarbons (substituted) & Derivatives;Highly Purified Reagents;Other Categories;Refined Products by Sublimation;Amines;C11 to C38;Nitrogen Compounds | | Mol File: | 2380-36-1.mol |  |
| | 3,5-DI-TERT-BUTYLANILINE Chemical Properties |
| Melting point | 54-57 °C (lit.) | | Boiling point | 276.6±29.0 °C(Predicted) | | density | 0.912±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Benzene,Alcohol | | form | powder to crystal | | pka | 4.79±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C14H23N/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,15H2,1-6H3 | | InChIKey | MJKNHXCPGXUEDO-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 | | CAS DataBase Reference | 2380-36-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29214990 |
| | 3,5-DI-TERT-BUTYLANILINE Usage And Synthesis |
| Uses | 3,5-Di-tert-butylaniline is a useful reactant for the synthesis of Tetraphenylethylenepyrrolo[3,?2-?b]?pyrrole, a fluorescent dye. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 41, p. 1653, 1963 DOI: 10.1139/v63-238 |
| | 3,5-DI-TERT-BUTYLANILINE Preparation Products And Raw materials |
|