- N-ACETYLHOMOPIPERAZINE
-
- $1.10 / 1g
-
2022-02-25
- CAS:61903-11-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
|
| | N-ACETYLHOMOPIPERAZINE Basic information |
| | N-ACETYLHOMOPIPERAZINE Chemical Properties |
| Boiling point | 275℃ | | density | 1.077 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.510 | | Fp | 120℃ | | storage temp. | -20°C | | pka | 9.82±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Sensitive | Air Sensitive | | BRN | 606764 | | InChI | InChI=1S/C7H14N2O/c1-7(10)9-5-2-3-8-4-6-9/h8H,2-6H2,1H3 | | InChIKey | TWJPZMYNUBAUGA-UHFFFAOYSA-N | | SMILES | C(=O)(N1CCCNCC1)C | | CAS DataBase Reference | 61903-11-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | F | 3-10-34 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 |
| | N-ACETYLHOMOPIPERAZINE Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid |
| | N-ACETYLHOMOPIPERAZINE Preparation Products And Raw materials |
|