| Company Name: |
Shaanxi Istare Biotechnology Co., Ltd.
|
| Tel: |
18682931470; 18682931470 |
| Email: |
2142355700@qq.com |
| Products Intro: |
Product Name:N-(2-Chloro-4-fluorophenyl)-2,3,5,6-tetramethylbenzenesulfonamide
CAS:2325172-54-9
Purity:98% Package:1g
|
| Company Name: |
Anhui JYHX CO., LTD.
|
| Tel: |
0551-68788198 13295518198 |
| Email: |
wangyanan@ahjyhx.com |
| Products Intro: |
CAS:2325172-54-9
Purity:95% 97% 98% HPLC Package:MG;G;10G;100G;500G;1kg;100kg;1000kg
|
|
| | Benzenesulfonamide, N-(2-chloro-4-fluorophenyl)-2,3,5,6-tetramethyl- Basic information |
| Product Name: | Benzenesulfonamide, N-(2-chloro-4-fluorophenyl)-2,3,5,6-tetramethyl- | | Synonyms: | Benzenesulfonamide, N-(2-chloro-4-fluorophenyl)-2,3,5,6-tetramethyl-;N-(2-Chloro-4-fluorophenyl)-2,3,5,6-tetramethylbenzenesulfonamide | | CAS: | 2325172-54-9 | | MF: | C16H17ClFNO2S | | MW: | 341.83 | | EINECS: | | | Product Categories: | | | Mol File: | 2325172-54-9.mol |  |
| | Benzenesulfonamide, N-(2-chloro-4-fluorophenyl)-2,3,5,6-tetramethyl- Chemical Properties |
| Boiling point | 467.7±55.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | pka | 8.47±0.10(Predicted) |
| | Benzenesulfonamide, N-(2-chloro-4-fluorophenyl)-2,3,5,6-tetramethyl- Usage And Synthesis |
| | Benzenesulfonamide, N-(2-chloro-4-fluorophenyl)-2,3,5,6-tetramethyl- Preparation Products And Raw materials |
|