|
|
| | Adenosine5'-(tetrahydrogen triphosphate), disodiuM salt, trihydrate (9CI) Basic information |
| Product Name: | Adenosine5'-(tetrahydrogen triphosphate), disodiuM salt, trihydrate (9CI) | | Synonyms: | adenosine triphosphate (-Na2);Adenosine5'-(tetrahydrogen triphosphate), disodiuM salt, trihydrate (9CI);Adenosine 5'-triphosphate disodium salt trihydrate AldrichCPR;Adenosine-5'-triphosphate Disodium Salt Hydrate from Yeast;Adenosine 5μ-triphosphate (ATP) hydrate disodium salt;ATP hydrate disodium;Adenosine5'-triphosphate (ATP),disodium,hexahydrate;ADENOSIN-5'-TRIPHOSPHATE TETRASODIUM SALT, SOLUTION 100mM, MOLECULAR BIOLOGY GR | | CAS: | 51963-61-2 | | MF: | C10H19N5NaO14P3 | | MW: | 549.19 | | EINECS: | 213-579-1 | | Product Categories: | API;nucleoside | | Mol File: | 51963-61-2.mol |  |
| | Adenosine5'-(tetrahydrogen triphosphate), disodiuM salt, trihydrate (9CI) Chemical Properties |
| Melting point | 176°C | | storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL | | form | lyophilized powder | | color | White to off-white | | Water Solubility | Water: 250 mg/mL (413.09 mM) | | InChIKey | MWEQTWJABOLLOS-AZGWGOJFSA-L | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(=NC=NC1=2)N)O.[NaH].O |&1:1,2,3,19,r| | | CAS DataBase Reference | 51963-61-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | RTECS | AU7417000 | | TSCA | Yes | | Storage Class | 11 - Combustible Solids |
| | Adenosine5'-(tetrahydrogen triphosphate), disodiuM salt, trihydrate (9CI) Usage And Synthesis |
| Chemical Properties | Crystalline powder | | Uses | ATP, disodium salt, is used for the luminometric determination of Luc activity in cell extracts. | | Uses | P2 purinergic agonist; increases activity of Ca2+-activated K+ channels; substrate for ATP-dependent enzyme systems | | General Description | The product contains disodium salt crystals of ATP. | | Biological Activity | Adenosine 5μ-triphosphate (ATP) is a key energy currency, with high phosphate transfer potential, in all living organisms. ATP participates in several biological processes such as membrane transport, muscle contraction and synthesis, and degradation of biological molecules. It serves as an intracellular and extracellular signaling molecule in certain cellular processes such as cell motility, organ development, neurotransmission, and insulin secretion. Adenosine 5μ-triphosphate (ATP) acts as a substrate for proteins of the kinesin superfamily. | | in vivo | ATP disodium trihydrate (50 mg/kg; i.p.) protects mice against bacterial infection in vivo[4].
ATP disodium trihydrate induces the secretion of IL-1β, KC and MIP-2 and neutrophils recruitment in vivo[4].
| Animal Model: | Four-week-old Kunming mice (18-22 g)[4] | | Dosage: | 50 mg/kg | | Administration: | Intraperitoneal injection, before bacterial (E. coli) challenge | | Result: | Protected mice from bacterial infection. |
| | IC 50 | Human Endogenous Metabolite |
| | Adenosine5'-(tetrahydrogen triphosphate), disodiuM salt, trihydrate (9CI) Preparation Products And Raw materials |
|