|
|
| | FMOC-SARCOSINE MONOHYDRATE Basic information |
| | FMOC-SARCOSINE MONOHYDRATE Chemical Properties |
| Melting point | 117.0 to 121.0 °C | | Boiling point | 512.8±29.0 °C(Predicted) | | density | 1.292±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMF. | | form | powder to crystal | | pka | 3.91±0.10(Predicted) | | color | White to Almost white | | BRN | 6660958 | | Major Application | peptide synthesis | | InChI | InChI=1S/C18H17NO4/c1-19(10-17(20)21)18(22)23-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16H,10-11H2,1H3,(H,20,21) | | InChIKey | ZHKQIADIIYMFOZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CN(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C | | CAS DataBase Reference | 77128-70-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | FMOC-SARCOSINE MONOHYDRATE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Fmoc-N-methylglycine is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-SARCOSINE MONOHYDRATE Preparation Products And Raw materials |
|