- 3.5-difuoro-4-cyanophenol
-
- $6.00 / 1KG
-
2025-09-25
- CAS:123843-57-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,6-Difluoro-4-hydroxybenzonitrile Basic information |
| Product Name: | 2,6-Difluoro-4-hydroxybenzonitrile | | Synonyms: | 4-CYANO-3,5-DIFLUOROPHENOL;3,5-DIFLUORO-4-CYANOPHENOL;2,6-DIFLUORO-4-HYDROXYBENZONITRILE;4-Cyano-3,5-Difluorophenol/3,5-Difluoro-4-Cyanophenol;Benzonitrile, 2,6-difluoro-4-hydroxy- (9CI);2,6-Difluoro-4-hydroxy;4-Cyano-3,5-difluorophenol ,99%;2,6-Difluoro-4-hydro | | CAS: | 123843-57-2 | | MF: | C7H3F2NO | | MW: | 155.1 | | EINECS: | | | Product Categories: | Aromatic Nitriles;Phenol&Thiophenol&Mercaptan;HALIDE;Fluorobenzene;Alcohols and Derivatives;Boron, Nitrile, Thio,& TM-Cpds | | Mol File: | 123843-57-2.mol |  |
| | 2,6-Difluoro-4-hydroxybenzonitrile Chemical Properties |
| Melting point | 127 °C | | Boiling point | 279.8±40.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystaline | | pka | 5.87±0.23(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H3F2NO/c8-6-1-4(11)2-7(9)5(6)3-10/h1-2,11H | | InChIKey | KEIYYIGMDPTAPL-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C=C(O)C=C1F | | CAS DataBase Reference | 123843-57-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | RIDADR | 3439 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 |
| | 2,6-Difluoro-4-hydroxybenzonitrile Usage And Synthesis |
| Chemical Properties | Off-white Cryst | | Uses | Intermediates of Liquid Crystals |
| | 2,6-Difluoro-4-hydroxybenzonitrile Preparation Products And Raw materials |
|