| Company Name: |
Hangzhou Sage Chemical Co., Ltd.
|
| Tel: |
+86057186818502 13588463833 |
| Email: |
info@sagechem.com |
| Products Intro: |
Product Name:Hexanoic acid, 6-oxo- CAS:928-81-4 Purity:98% Package:1g;5g;100g;Bulk
|
| Company Name: |
Chongqing Acemol Technology Co.,Ltd
|
| Tel: |
023-86822659 18611316925 |
| Email: |
sales@acemol.com |
| Products Intro: |
Product Name:Hexan-1-one-6-carboxylate CAS:928-81-4 Purity:98% Package:10g,25g,100g,1kg,100kg
|
|
| | 6-oxohexanoic acid Basic information | | Uses |
| Product Name: | 6-oxohexanoic acid | | Synonyms: | 6-oxohexanoic acid;Adipic semialdehyde;δ-Formylvaleric acid;Hexanoic acid, 6-oxo-;Hexan-1-one-6-carboxylate;Cytidine-2′-d-3′,5′-C-d2, N-acetyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-, 3′-[2-cyanoethyl bis(1-methylethyl)phosphoramidite], (2′S)- (9CI) | | CAS: | 928-81-4 | | MF: | C6H10O3 | | MW: | 130.14 | | EINECS: | | | Product Categories: | | | Mol File: | 928-81-4.mol |  |
| | 6-oxohexanoic acid Chemical Properties |
| Melting point | 85 °C(Solv: ethanol (64-17-5)) | | Boiling point | 151-153 °C(Press: 20 Torr) | | density | 1.15 g/cm3(Temp: 15 °C) | | pka | 4.70±0.10(Predicted) | | InChI | InChI=1S/C6H10O3/c7-5-3-1-2-4-6(8)9/h5H,1-4H2,(H,8,9) | | InChIKey | PNPPVRALIYXJBW-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCC=O |
| | 6-oxohexanoic acid Usage And Synthesis |
| Uses | 6-Oxohexanoic acid can be used for sample preparation in microbial identification and plant physiology research, as well as as a raw material for animal feed, cosmetics, and pharmaceuticals. | | Definition | ChEBI: A medium-chain fatty acid comprising hexanoic acid carrying an oxo group at position 6. |
| | 6-oxohexanoic acid Preparation Products And Raw materials |
|