Company Name: |
UkrOrgSynthesis Ltd.
|
Tel: |
380 445319497 |
Email: |
y.barysheva@ukrorgsynth.com |
Products Intro: |
|
|
| 3-(benzylamino)oxolan-2-one Basic information |
| 3-(benzylamino)oxolan-2-one Chemical Properties |
Melting point | 220 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | InChI | InChI=1S/C11H13NO2/c13-11-10(6-7-14-11)12-8-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2 | InChIKey | GYAWQIHUDRAWSZ-UHFFFAOYSA-N | SMILES | O1CCC(NCC2=CC=CC=C2)C1=O |
| 3-(benzylamino)oxolan-2-one Usage And Synthesis |
Uses | 3-(benzylamino)oxolan-2-one is a useful research chemical, used as intermediate of corectim ints. |
| 3-(benzylamino)oxolan-2-one Preparation Products And Raw materials |
|