|
|
| | 3-Bromo-4-fluorobenzaldehyde Basic information |
| | 3-Bromo-4-fluorobenzaldehyde Chemical Properties |
| Melting point | 31-33 °C (lit.) | | Boiling point | 138-139 °C/2.5 mmHg (lit.) | | density | 1.6698 (rough estimate) | | refractive index | 1.574 | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Low Melting Solid | | color | White to light yellow | | Water Solubility | INSOLUBLE | | Sensitive | Air Sensitive | | BRN | 5806226 | | InChI | InChI=1S/C7H4BrFO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H | | InChIKey | FAHZIKXYYRGSHF-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(F)C(Br)=C1 | | CAS DataBase Reference | 77771-02-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzaldehyde, 3-bromo-4-fluoro- (77771-02-9) |
| | 3-Bromo-4-fluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | white to light yellow low melting solid | | Uses | 3-Bromo-4-fluorobenzaldehyde was used in the synthesis of 4-fluoro-3-phenoxybenzoic acid-glycine. It was also used in the synthesis of Schiff bases of 4-nitroaniline/ 2,4-dinitroaniline/3,4-dichloroaniline/4-methoxy-3-nitro aniline via ultrasound irradiation method. | | Uses | 3-Bromo-4-fluorobenzaldehyde can be used for pest control. |
| | 3-Bromo-4-fluorobenzaldehyde Preparation Products And Raw materials |
|