|
|
| | 4-Chloro-N-methylaniline Basic information |
| | 4-Chloro-N-methylaniline Chemical Properties |
| Boiling point | 239 °C (lit.) | | density | 1.169 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.584(lit.) | | Fp | 125 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | liquid | | pka | pK1: 3.9(+1) (25°C) | | Appearance | Light yellow to yellow Liquid | | BRN | 2205846 | | InChI | InChI=1S/C7H8ClN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 | | InChIKey | XCEYKKJMLOFDSS-UHFFFAOYSA-N | | SMILES | C1(NC)=CC=C(Cl)C=C1 | | CAS DataBase Reference | 932-96-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 4-chloro-N-methyl-(932-96-7) |
| | 4-Chloro-N-methylaniline Usage And Synthesis |
| Chemical Properties | clear yellow to yellow-brown liquid |
| | 4-Chloro-N-methylaniline Preparation Products And Raw materials |
|