|
|
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride Basic information | | Stability Storage |
| Product Name: | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride | | Synonyms: | RAC-DICHLOROETHYLENEBIS-(4,5,6,7-TETRAHYDRO-1-INDENYL)-ZIRCONIUM(IV);RAC-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM(IV) DICHLORIDE;RAC-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM DICHLORIDE;RAC-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM;(R)-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM DICHLORIDE;(S)-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)ZIRCONIUM DICHLORIDE;DICHLORO[RAC-ETHYLENEBIS(4,5,6,7-TETRAHYDRO-1-INDENYL)]ZIRCONIUM(IV);DICHLORO-(S,S)-ETHYLENEBIS-(4,5,6,7-TETRAHYDRO-1-INDENYL)-ZIRCONIUM(IV) | | CAS: | 100163-29-9 | | MF: | C20H24Cl2Zr10* | | MW: | 426.53 | | EINECS: | 202-303-5 | | Product Categories: | metallocene;Zr;Catalysis and Inorganic Chemistry;Chemical Synthesis;Zirconium | | Mol File: | 100163-29-9.mol | ![rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride Structure](CAS/GIF/100163-29-9.gif) |
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride Chemical Properties |
| Melting point | 267-271 °C(lit.) | | form | Powder | | color | white to pale yellow | | Sensitive | moisture sensitive | | InChI | InChI=1S/C20H24.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h9-12H,1-8,13-14H2;2*1H;/q;;;+2/p-2 | | InChIKey | AKXWJOYQORUUHS-UHFFFAOYSA-L | | SMILES | [C]12[C]([CH][CH][C]1CCCC2)CC[C]1[CH][CH][C]2CCCC[C]12.[Zr](Cl)Cl |^1:0,1,2,3,4,11,12,13,14,19| |
| Hazard Codes | C,Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-45-36 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride Usage And Synthesis |
| Stability | Stable under normal temperature and pressure, avoid contact with water and oxidants. | | Storage | sealed storage, stored in a cool, dry warehouse. Keep away from oxidants, water sources. | | Chemical Properties | White to pale yellow powder,it can carry out catalytic reaction. | | Uses | Catalyst for: Regiochemistry in Negishi carboaluminations Polymerization of olefins Diastereoselective intramolecular olefin alkylations Asymmetric carbomagnesiation Reduction of esters to alcohols Enantioselective synthesis of allylic amines | | Uses | Rac-Ethylenebis(tetrahydroindenyl)zirconium Dichloride is a catalyst for enantioselective methylalumination of monosubstituted alkenes.The Kaminsky catalyst with co-catalyst methylaluminoxane (MAO) is a type of Ziegler-Natta catalyst, showing extremely high activity for polymerization of olefins such as ethylene, propylene, and styrene. | | reaction suitability | core: zirconium reagent type: catalyst |
| | rac-Ethylenebis(4,5,6,7-tetrahydro-1-indenyl)]zirconium dichloride Preparation Products And Raw materials |
|