|
|
| | 2-(5-Hexyl-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-(5-Hexyl-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | 2-(5-Hexyl-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;5-Hexyl-2-thiopheneboronic acid pinacol ester;2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;5-Hexylthiopheneboronic acid pinacol ester;5-hexylthiophen-2-boronic acid pinacol ester;5-Hexyl-2-thiopheneboronic acid pinacol ester 97%;2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-hexylthiophene;5-Hexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene | | CAS: | 917985-54-7 | | MF: | C16H27BO2S | | MW: | 294.26 | | EINECS: | | | Product Categories: | Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Heteroaryl Boronate Esters;Materials Science;Organic and Printed Electronics;Organometallic Reagents;Synthetic Tools and Reagents;Thiophene Monomers and Building Blocks | | Mol File: | 917985-54-7.mol |  |
| | 2-(5-Hexyl-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 140-142 °C/0.5 mmHg | | density | 0.977 g/mL at 25 °C | | refractive index | n20/D 1.5 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C16H27BO2S/c1-6-7-8-9-10-13-11-12-14(20-13)17-18-15(2,3)16(4,5)19-17/h11-12H,6-10H2,1-5H3 | | InChIKey | FWZQTJFOKCBQGX-UHFFFAOYSA-N | | SMILES | CCCCCCc1ccc(s1)B2OC(C)(C)C(C)(C)O2 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids |
| | 2-(5-Hexyl-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| Chemical Properties | Orange-red liquid |
| | 2-(5-Hexyl-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|