2-Chloro-4-fluoro-5-nitrobenzaldehyde manufacturers
|
| 2-Chloro-4-fluoro-5-nitrobenzaldehyde Basic information |
Product Name: | 2-Chloro-4-fluoro-5-nitrobenzaldehyde | Synonyms: | 2-Chloro-4-fluoro-5-nitrobenzaldehyde;2-Chloro-4-fluoro-5-nitrobenzaldehy;Benzaldehyde, 2-chloro-4-fluoro-5-nitro-;3-Pyridinecarbonitrile,6-fluoro-7-nitro-;2-Chlor-4-fluor-5-nitrobenzaldehyd | CAS: | 99329-85-8 | MF: | C7H3ClFNO3 | MW: | 203.55 | EINECS: | | Product Categories: | | Mol File: | 99329-85-8.mol | |
| 2-Chloro-4-fluoro-5-nitrobenzaldehyde Chemical Properties |
Boiling point | 303.6±42.0 °C(Predicted) | density | 1.576±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | InChI | InChI=1S/C7H3ClFNO3/c8-5-2-6(9)7(10(12)13)1-4(5)3-11/h1-3H | InChIKey | HNOIAPRHNXBCAE-UHFFFAOYSA-N | SMILES | C(=O)C1=CC([N+]([O-])=O)=C(F)C=C1Cl |
| 2-Chloro-4-fluoro-5-nitrobenzaldehyde Usage And Synthesis |
| 2-Chloro-4-fluoro-5-nitrobenzaldehyde Preparation Products And Raw materials |
|