|
|
| | Ruthenium acetylacetonate Basic information |
| | Ruthenium acetylacetonate Chemical Properties |
| Melting point | 260 °C (dec.)(lit.) | | storage temp. | Store below +30°C. | | form | Crystalline | | color | White | | Water Solubility | Soluble in most organic solvents such as acetone, chlorinated hydrocarbons, alcohols, cyclohexane and benzene. Insoluble in water. | | InChI | InChI=1S/3C5H8O2.Ru/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; | | InChIKey | RTZYCRSRNSTRGC-LNTINUHCSA-K | | SMILES | [Ru](O/C(/C)=C\C(=O)C)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C | | EPA Substance Registry System | Ruthenium, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (14284-93-6) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 10 | | TSCA | TSCA listed | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids |
| | Ruthenium acetylacetonate Usage And Synthesis |
| Chemical Properties | dark-red crystals | | Uses | Precursor for the preparation of other compounds of ruthenium. Ruthenium(III) 2,4-pentanedionate is employed as a recyclable catalyst for certain organic transformations like the acetylation of phenols, alcohols, and amines under neat conditions. It is also used as a homogeneous catalyst, for example, in the hydrolysis of sodium borohydride and regiospecific tritiation of aromatic carboxylic acids. It is also used as a catalyst for enantioselective hydrogenation of acids such as aryl acrylic acid and aryl propenic acid. | | reaction suitability | core: ruthenium
reagent type: catalyst | | Purification Methods | Purify the complex by recrystallisation from *benzene. [Wilkinson J Am Chem Soc 74 6146 1952, Beilstein 1 IV 3677.] |
| | Ruthenium acetylacetonate Preparation Products And Raw materials |
|