- o-AdaMantylanisole
-
- $1.60 / 100kg
-
2026-04-17
- CAS:43109-77-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | o-AdaMantylanisole Basic information |
| Product Name: | o-AdaMantylanisole | | Synonyms: | o-AdaMantylanisole;1-(2-Methoxyphenyl)ticyclo[3.3.1.13,7]decane;1-(o-Methoxyphenyl)adaMantane;Adapalene Related CoMpound C;1-(2-Methoxyphenyl)-tricyclo[3.3.1.13,7]decane;Adapalene Related Compound C (25 mg) (2-(adamant-1-yl)methoxybenzene);Adapalene Related Compound C (2-(adamant-1-yl)methoxybenzene) (1011732);Adapalene Impurity 7 | | CAS: | 43109-77-9 | | MF: | C17H22O | | MW: | 242.36 | | EINECS: | | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 43109-77-9.mol |  |
| | o-AdaMantylanisole Chemical Properties |
| Melting point | 107-109°C | | Boiling point | 355.2±21.0 °C(Predicted) | | density | 1.089±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly, Heated) | | form | solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C17H22O/c1-18-16-5-3-2-4-15(16)17-9-12-6-13(10-17)8-14(7-12)11-17/h2-5,12-14H,6-11H2,1H3 | | InChIKey | HYSZKSPAPGPYFQ-UHFFFAOYSA-N | | SMILES | C12(C3=CC=CC=C3OC)CC3CC(CC(C3)C1)C2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2918992090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | o-AdaMantylanisole Usage And Synthesis |
| Uses | o-AdaMantylanisole is an Adamantane anisole derivative used in reaction of adamantane derivatives, including the use of 1-adamantyl, 1-adamantylthio, and 1-adamantylsulfinyl groups as protective groups in amino acid and pe ptide synthesis. |
| | o-AdaMantylanisole Preparation Products And Raw materials |
|