|
|
| | 3,7-Dibromodibenzo[b,d]thiophene Basic information |
| Product Name: | 3,7-Dibromodibenzo[b,d]thiophene | | Synonyms: | 3,7-dibroModibenzothiophene;3,7-DibroModibenzo[b,d]thiophene;3,7-Dibromodibenzo[b,d]thiophene;3,7-Dibromodibenzo[b,d]thiophene>;Dibenzothiophene, 3,7-dibromo-;DK444;3,7-Dibromobenzo[b]benzo[b]thiophene;Dibromodibenzothioph | | CAS: | 83834-10-0 | | MF: | C12H6Br2S | | MW: | 342.05 | | EINECS: | | | Product Categories: | | | Mol File: | 83834-10-0.mol | ![3,7-Dibromodibenzo[b,d]thiophene Structure](CAS/20150408/GIF/83834-10-0.gif) |
| | 3,7-Dibromodibenzo[b,d]thiophene Chemical Properties |
| Melting point | 176℃ | | Boiling point | 436.5±25.0 °C(Predicted) | | density | 1.905±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C12H6Br2S/c13-7-1-3-9-10-4-2-8(14)6-12(10)15-11(9)5-7/h1-6H | | InChIKey | KMNBVODPWIFUSS-UHFFFAOYSA-N | | SMILES | C12=CC(Br)=CC=C1C1=CC=C(Br)C=C1S2 |
| | 3,7-Dibromodibenzo[b,d]thiophene Usage And Synthesis |
| Uses | 3,7-Dibromodibenzo[b,d]thiophene can be used for the synthesis of nitrogen-containing compounds, electronic components and materials for electronic devices. |
| | 3,7-Dibromodibenzo[b,d]thiophene Preparation Products And Raw materials |
|