| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine CAS:1346242-32-7 Package:100Mg,1g
|
| Company Name: |
Chemsky(shanghai)International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:(αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine CAS:1346242-32-7 Purity:98%
|
| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Rivastigmine Impurity 18 CAS:1346242-32-7 Purity:98% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | (αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine Basic information |
| Product Name: | (αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine | | Synonyms: | (αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine;(S)-N,N-DiMethyl-1-(3-(4-nitrophenoxy)phenyl)ethanaMine;Rivastigmine Ether Impurity (USP);Rivastigmine Impurity 13;Rivastigmine Ether Imp;(S)-N,N-Dimethyl-1-(3-(4-nitrophenoxy)ph;(1S)-N,N-dimethyl-1-[3-(4-nitrophenoxy)phenyl]ethanamine;Benzenemethanamine, N,N,α-trimethyl-3-(4-nitrophenoxy)-, (αS)- | | CAS: | 1346242-32-7 | | MF: | C16H18N2O3 | | MW: | 286.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1346242-32-7.mol |  |
| | (αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine Chemical Properties |
| Boiling point | 366.3±27.0 °C(Predicted) | | density | 1.165±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 8.56±0.50(Predicted) | | color | Dark Yellow to Orange | | InChI | InChI=1/C16H18N2O3/c1-12(17(2)3)13-5-4-6-16(11-13)21-15-9-7-14(8-10-15)18(19)20/h4-12H,1-3H3/t12-/s3 | | InChIKey | IGNXGHWUJLKYJA-PLAQIDKDNA-N | | SMILES | [C@H](C1=CC=CC(OC2=CC=C([N+]([O-])=O)C=C2)=C1)(N(C)C)C |&1:0,r| |
| | (αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine Usage And Synthesis |
| Uses | (αS)-N,N,α-Trimethyl-3-(4-nitrophenoxy)benzenemethanamine is an impurity of Rivastigmine Tartrate (R541000). Rivastigmine Tartrate is a brain selective acetylcholinesterase inhibitor. |
| | (αS)-N,N,α-TriMethyl-3-(4-nitrophenoxy)benzeneMethanaMine Preparation Products And Raw materials |
|