BroModifluoroMethyl phenyl sulfone manufacturers
|
| | BroModifluoroMethyl phenyl sulfone Basic information |
| Product Name: | BroModifluoroMethyl phenyl sulfone | | Synonyms: | BroModifluoroMethyl phenyl sulfone;Bromodifluoromethanesulfonylbenzene;[(bromodifluoromethyl)sulfonyl]benzene;Benzene, [(bromodifluoromethyl)sulfonyl]- | | CAS: | 80351-58-2 | | MF: | C7H5BrF2O2S | | MW: | 271.08 | | EINECS: | | | Product Categories: | | | Mol File: | 80351-58-2.mol |  |
| | BroModifluoroMethyl phenyl sulfone Chemical Properties |
| Melting point | 33-34 °C | | Boiling point | 291.8±40.0 °C(Predicted) | | density | 1.745±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), DMSO (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C7H5BrF2O2S/c8-7(9,10)13(11,12)6-4-2-1-3-5-6/h1-5H | | InChIKey | VYNTWHUALGNGNU-UHFFFAOYSA-N | | SMILES | C1(S(C(Br)(F)F)(=O)=O)=CC=CC=C1 |
| Safety Statements | 24/25 | | HS Code | 29309090 |
| | BroModifluoroMethyl phenyl sulfone Usage And Synthesis |
| Description | The nucleophilic reactions of bromodifluoromethyl phenyl sulfone with electrophiles such as
aldehydes in the presence of TDAE affords (phenylsulfonyl)difluoromethyl-containing
synthetically useful intermediates. Palladium-mediated reactions of styrene derivatives, vinyl
ethers, and heteroaromatics with bromodifluoromethyl phenyl sulfone in the presence of
potassium carbonate affords the (phenylsulfonyl)difluoromethylated products. | | Uses | Bromodifluoromethyl phenyl sulfone is an intermediate component in the synthesis of (phenylsulfonyl)difluoromethyl and can be used to prepare (phenylsulfonyl)difluoromethylated products by palladium-mediated reactions. | | Uses | Bromodifluoromethyl Phenyl Sulfone can be used to prepare difluoromethyl ethers via difluoromethylation of alcohols. | | Reactions | (1) Difluoromethylation of aldehydes.
(2) Difluoromethylation of styrenes, vinyl ethers, and heteroaromatics.
| | References | [1] G.K. SURYA PRAKASH . Nucleophilic difluoromethylation and difluoromethylenation using bromodifluoromethyl phenyl sulfone[J]. Journal of Fluorine Chemistry, 2005. DOI:10.1016/j.jfluchem.2005.07.011.
[2] NAKIN SURAPANICH. ChemInform Abstract: Palladium-Mediated Heck-Type Reactions of [(Bromodifluoromethyl)sulfonyl]benzene: Synthesis of α-Alkenyl- and α-Heteroaryl-Substituted α,α-Difluoromethyl Phenyl Sulfones.[J]. ChemInform, 2013. DOI:10.1002/chin.201314090.
|
| | BroModifluoroMethyl phenyl sulfone Preparation Products And Raw materials |
|