- FPH2
-
- $39.00 / 5mg
-
2026-04-20
- CAS:957485-64-2
- Min. Order:
- Purity: 99.70%
- Supply Ability: 10g
|
| Product Name: | FPH2 | | Synonyms: | FPH2;FPH2(BRD-9424);4-[[[(5-chloro-2-methoxyphenyl)amino]thioxomethyl]amino]-1-ethyl-1H-pyrazole-3-carboxamide;4-(3-(5-Chloro-2-methoxyphenyl)thioxureido)-1-ethyl-1H-pyrazole-3-carboxamide;BRD-9424;4-[(5-chloro-2-methoxyphenyl)carbamothioylamino]-1-ethylpyrazole-3-carboxamide;CS-2516;4-[3-(5-Chloro-2-methoxyphenyl)thioureido]-1-ethyl-1H-pyrazole-3-carboxamide | | CAS: | 957485-64-2 | | MF: | C14H16ClN5O2S | | MW: | 353.83 | | EINECS: | 604-604-1 | | Product Categories: | Inhibitors | | Mol File: | 957485-64-2.mol |  |
| Boiling point | 537.5±60.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO: soluble10mg/mL, clear | | form | powder | | pka | 11.31±0.70(Predicted) | | color | white to beige | | InChI | InChI=1S/C14H16ClN5O2S/c1-3-20-7-10(12(19-20)13(16)21)18-14(23)17-9-6-8(15)4-5-11(9)22-2/h4-7H,3H2,1-2H3,(H2,16,21)(H2,17,18,23) | | InChIKey | PCHRYHSDDPPZBV-UHFFFAOYSA-N | | SMILES | N1(CC)C=C(NC(NC2=CC(Cl)=CC=C2OC)=S)C(C(N)=O)=N1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Description | BRD-9424, also known as functional proliferation hit 2 (FPH2), is a small molecule that induces proliferation of primary human hepatocytes in vitro. | | Uses | FPH2 induces of functional proliferation of primary human hepatocytes and may lead to the development of new therapeutics for liver diseases. | | Definition | ChEBI: 4-[[(5-chloro-2-methoxyanilino)-sulfanylidenemethyl]amino]-1-ethyl-3-pyrazolecarboxamide is a member of thioureas. | | references | [1]. shan j, schwartz re, ross nt, et al. identification of small molecules for human hepatocyte expansion and ips differentiation. nat chem biol, 2013, 9(8): 514-520. |
| | FPH2 Preparation Products And Raw materials |
|