5-MethyoxycarbonylMethyl 2-thiouracil manufacturers
|
| | 5-MethyoxycarbonylMethyl 2-thiouracil Basic information |
| Product Name: | 5-MethyoxycarbonylMethyl 2-thiouracil | | Synonyms: | 5-MethyoxycarbonylMethyl 2-thiouracil;1,2,3,4-Tetrahydro-4-oxo-2-thioxo-5-pyrimidineacetic acid methyl ester;5-Methoxycarbonylmethyl 2-thiouracil;5-Pyrimidineacetic acid, 1,2,3,4-tetrahydro-4-oxo-2-thioxo-, methyl ester;Methyl 2-(4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidin-5-yl)acetate | | CAS: | 29571-40-2 | | MF: | C7H8N2O3S | | MW: | 200.21 | | EINECS: | | | Product Categories: | | | Mol File: | 29571-40-2.mol |  |
| | 5-MethyoxycarbonylMethyl 2-thiouracil Chemical Properties |
| density | 1.42±0.1 g/cm3(Predicted) | | pka | 7.11±0.25(Predicted) | | InChI | InChI=1S/C7H8N2O3S/c1-12-5(10)2-4-3-8-7(13)9-6(4)11/h3H,2H2,1H3,(H2,8,9,11,13) | | InChIKey | DGRUIWRQODIJRI-UHFFFAOYSA-N | | SMILES | C1(=S)NC=C(CC(OC)=O)C(=O)N1 |
| | 5-MethyoxycarbonylMethyl 2-thiouracil Usage And Synthesis |
| | 5-MethyoxycarbonylMethyl 2-thiouracil Preparation Products And Raw materials |
|