PotassiuM (Mix)-2-buten-2-yltrifluoroborate manufacturers
|
| | PotassiuM (Mix)-2-buten-2-yltrifluoroborate Basic information |
| Product Name: | PotassiuM (Mix)-2-buten-2-yltrifluoroborate | | Synonyms: | Potassium (2Z)-2-buten-2-yl(trifluoro)borate(1-);PotassiuM (Mix)-2-buten-2-yltrifluoroborate;Potassium (2Z)-2-buten-2-yltrifluoroborate >=95%;potassium:[(Z)-but-2-en-2-yl]-trifluoroboranuide;Potassium (Z)-but-2-en-2-yltrifluoroborate;Borate(1-), trifluoro[(1Z)-1-methyl-1-propen-1-yl]-, potassium (1:1), (T-4)-;Potassium (Z)-2-Buten-2-yltrifluoroborate;Potassium (2Z)-2-buten-2-yltrifluoroborate | | CAS: | 1134643-88-1 | | MF: | C4H7BF3K | | MW: | 162.0028896 | | EINECS: | | | Product Categories: | | | Mol File: | 1134643-88-1.mol |  |
| | PotassiuM (Mix)-2-buten-2-yltrifluoroborate Chemical Properties |
| Melting point | 147-152°C | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H7BF3.K/c1-3-4(2)5(6,7)8;/h3H,1-2H3;/q-1;+1/b4-3+; | | InChIKey | IFJZXYDBLMMRCO-BJILWQEISA-N | | SMILES | [K+].[B-](/C(=C/C)/C)(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2931900090 |
| | PotassiuM (Mix)-2-buten-2-yltrifluoroborate Usage And Synthesis |
| Uses | Potassium (2Z)-2-buten-2-yltrifluoroborate can be used as a substrate:
- In the asymmetric alkenylation of imines/aldimines using a rhodium based catalyst.
- In the Rh(I)-catalyzed allylic amines synthesis by reacting with N-tert-butanesulfinyl aldimines.
- In the ytterbium triflate catalyzed multicomponent synthesis of β-unsaturated α-amino esters.
|
| | PotassiuM (Mix)-2-buten-2-yltrifluoroborate Preparation Products And Raw materials |
|