- Schisandrone
-
- $58.00 / 1mg
-
2025-12-08
- CAS:98619-25-1
- Min. Order:
- Purity: 99.84%
- Supply Ability: 10g
- Schisandrone
-
- $0.00 / 5mg
-
2023-02-24
- CAS:98619-25-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Arisantetralone C Basic information |
| Product Name: | Arisantetralone C | | Synonyms: | Arisantetralone C;Schisandrone;1(2H)-Naphthalenone, 4-(3,4-dimethoxyphenyl)-3,4-dihydro-7-hydroxy-6-methoxy-2,3-dimethyl-, (2S,3S,4R)-;(2S,3S,4R)-4-(3,4-Dimethoxyphenyl)-7-hydroxy-6-methoxy-2,3-dimethyl-3,4-dihydronaphthalen-1(2H)-one | | CAS: | 98619-25-1 | | MF: | C21H24O5 | | MW: | 356.41 | | EINECS: | | | Product Categories: | | | Mol File: | 98619-25-1.mol |  |
| | Arisantetralone C Chemical Properties |
| Melting point | 180-181℃ | | Boiling point | 508.2±50.0 °C(Predicted) | | density | 1.159±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Cryst. | | pka | 9.38±0.70(Predicted) | | color | White to off-white | | InChI | InChI=1S/C21H24O5/c1-11-12(2)21(23)15-9-16(22)18(25-4)10-14(15)20(11)13-6-7-17(24-3)19(8-13)26-5/h6-12,20,22H,1-5H3/t11-,12+,20-/m1/s1 | | InChIKey | DRKPZVVNEGETTG-XAAFQQQXSA-N | | SMILES | C1(=O)C2=C(C=C(OC)C(O)=C2)[C@@H](C2=CC=C(OC)C(OC)=C2)[C@H](C)[C@@H]1C |
| | Arisantetralone C Usage And Synthesis |
| Uses | Schisandrone is a new 4-?aryltetralone lignan isolated from the dried fruits of Schisandra sphenanthera. Schisandrone improves learning and memory abilities of rats with Alzheimer-like disease. | | in vivo | Schisandrone (40 mg/kg, s.c.) combined with antibiotic Ceftiofur exhibits a significant therapeutic effect on S. aureusinfection in mice[2].
| Animal Model: | S. aureus-infected mice[2] | | Dosage: | 40 mg/kg | | Administration: | Subcutaneous injection (s.c.) | | Result: | Combined with ceftiofur reduced The MIC of ceftiofur, from 32 μg/mL to 2 μg/mL.
Showed the survival rate of 30%.
|
| | target | NF-kB | NOS | Beta Amyloid |
| | Arisantetralone C Preparation Products And Raw materials |
|