|
|
| | 6,6'-Dimethyl-2,2'-dipyridyl Basic information |
| Product Name: | 6,6'-Dimethyl-2,2'-dipyridyl | | Synonyms: | 6,6''-BI-2-PICOLINE 98+%;6,6-DIMETHYL-2,2-DIPYRIDYL;6,6'-DI-2-PICOLYL;AKOS BBS-00000187;2-methyl-6-(6-methyl-2-pyridyl)pyridine;6,6'-Bi-2-picoline
6,6'-Di-2-picolyl;2,2'-Bipyridine, 6,6'-diMethyl-;6'-DiMethyl-2,2'-dipyridyl | | CAS: | 4411-80-7 | | MF: | C12H12N2 | | MW: | 184.24 | | EINECS: | 224-566-5 | | Product Categories: | Heterocyclic Building Blocks;Pyridines;C9 to C46;4411-80-7 | | Mol File: | 4411-80-7.mol |  |
| | 6,6'-Dimethyl-2,2'-dipyridyl Chemical Properties |
| Melting point | 93-95 °C(lit.) | | Boiling point | 286 °C | | density | 1.060±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | form | powder to crystaline | | pka | 5.20±0.22(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C12H12N2/c1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12/h3-8H,1-2H3 | | InChIKey | OHJPGUSXUGHOGE-UHFFFAOYSA-N | | SMILES | C1(C2=NC(C)=CC=C2)=NC(C)=CC=C1 | | CAS DataBase Reference | 4411-80-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | DW1767000 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6,6'-Dimethyl-2,2'-dipyridyl Usage And Synthesis |
| Chemical Properties | White to light brown crystal or powder | | Uses | 6,6′-dimethyl-2,2′-bipyridyl (6,6′-Dimethyl-2,2′-bipyridine)may be used in the synthesis of novel oligobipyridine ligands. | | General Description | 6,6′-dimethyl-2,2′-bipyridyl (dmbp) also known as 6,6′-dimethyl-2,2′-bipyridine, is commonly used as a ligand to form complexes with ions such as Pd(II), Pt(II), Cu(II), Co(II) and Zn(II). The crystalline structure of dmbp has been investigated. Its synthesis from 6-bromopicoline has been reported. |
| | 6,6'-Dimethyl-2,2'-dipyridyl Preparation Products And Raw materials |
|