|
|
| | tert-Butyl 2-(dimethoxyphosphoryl)acetate Basic information |
| Product Name: | tert-Butyl 2-(dimethoxyphosphoryl)acetate | | Synonyms: | tert-Butyl P,P-diMethylphosphonoacetate, >= 97.0 % GC;tert-Butyl ((oxo)dimethoxyphosphino)acetate;tert-Butyl (dimethoxyphosphinyl)acetate;tert-Butyl 2-(dimethoxyphosphoryl);TERT-BUTYL P,P-DIMETHYLPHOSPHONOACETATE;tert-Butyl O,O-dimethylphosphonoacetate;DIMETHYL TERT-BUTOXYCARBONYL-METHYLPHOSPHONATE;Tert-butyl dimethylphosphonoactate | | CAS: | 62327-21-3 | | MF: | C8H17O5P | | MW: | 224.19 | | EINECS: | | | Product Categories: | | | Mol File: | 62327-21-3.mol |  |
| | tert-Butyl 2-(dimethoxyphosphoryl)acetate Chemical Properties |
| Boiling point | 86-87 °C0.02 mm Hg(lit.) | | density | 1.131 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.434 | | Fp | 110 ºC | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 4861886 | | InChI | InChI=1S/C8H17O5P/c1-8(2,3)13-7(9)6-14(10,11-4)12-5/h6H2,1-5H3 | | InChIKey | SAZYDWOWLRDDRQ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CP(OC)(OC)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 9-23 | | HS Code | 2931.39.0030 |
| | tert-Butyl 2-(dimethoxyphosphoryl)acetate Usage And Synthesis |
| Uses | Reactant for:
- Preparation of phosphonate terminated PPH dendrimers as anti-HIV-1 agents
- Preparation of monodehydro diketopiperazines from ketoacyl amino acid amides via acid-catalyzed cyclization
- Preparation of α,β-unsaturated esters for use in the guanidine-catalyzed oxa-Michael addition
- Preparation of myxopyronin B and desmethyl myxopyronin B analogs, with antibacterial activity and inhibitory activity against bacterial RNA polymerase
- Allylation and subsequent ring-closing metathesis in presence of Grubbs′ catalyst or intramolecular rhodium-catalyzed cyclopropanation reactions
|
| | tert-Butyl 2-(dimethoxyphosphoryl)acetate Preparation Products And Raw materials |
|