| Company Name: |
Shanghai Anmike Chemical Co. Ltd. Gold
|
| Tel: |
18019252918 |
| Email: |
sale@amkchem.com |
| Products Intro: |
Product Name:6-Chloro-2-iodo-3-methoxypyridine
CAS:1256790-05-2
Purity:97% Package:1g,100g,1kg
|
| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:6-Chloro-2-iodo-3-methoxy-pyridine
CAS:1256790-05-2
Purity:95% Package:1g;5g Remarks:B1-5299
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 18112977050 |
| Email: |
cb6@aikonchem.com |
| Products Intro: |
Product Name:6-Chloro-2-iodo-3-methoxypyridine
CAS:1256790-05-2
Purity:95% HPLC or GC Package:10G,5G;1G
|
| Company Name: |
Hebei Huaxing Chemical Co., Ltd
|
| Tel: |
0319-6931777 13930968617 |
| Email: |
630669494@qq.com |
| Products Intro: |
Product Name:6-Chloro-2-iodo-3-methoxypyridine
CAS:1256790-05-2
Purity:98% Package:5KG;1KG
|
|
| | 6-Chloro-2-iodo-3-methoxy-pyridine Basic information |
| | 6-Chloro-2-iodo-3-methoxy-pyridine Chemical Properties |
| Boiling point | 303.9±42.0 °C(Predicted) | | density | 1.915±0.06 g/cm3(Predicted) | | pka | -7.13±0.10(Predicted) | | InChI | InChI=1S/C6H5ClINO/c1-10-4-2-3-5(7)9-6(4)8/h2-3H,1H3 | | InChIKey | SYDPZCLUEAZSMB-UHFFFAOYSA-N | | SMILES | C1(I)=NC(Cl)=CC=C1OC |
| | 6-Chloro-2-iodo-3-methoxy-pyridine Usage And Synthesis |
| | 6-Chloro-2-iodo-3-methoxy-pyridine Preparation Products And Raw materials |
|