- P-XYLENOL BLUE
-
- $0.00 / 25kg
-
2025-12-29
- CAS:125-31-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | P-XYLENOL BLUE Basic information |
| Product Name: | P-XYLENOL BLUE | | Synonyms: | phenol,4,4’-(3h-2,1-benzoxathiol-3-ylidene)bis[2,5-dimethyl-,s,s-dioxide;1,4-DIMETHYL-5-HYDROXYBENZENESULFONPHTHALEIN;4,4-(3H-2,1-benzoxathiol-3-ylidene)bis(2,5-dimethylphenol) S,S-dioxide;p-Xylenolsulphonephthalein;XYLENOL BLUE, INDICATOR GRADE;XYLENOL BLUE FREE ACID;P-XYLENOL BLUE INDICATOR;P-XYLENOL BLUE (0.04% IN CA. 95% ETHANOL) [FOR PH DETERMINATION] | | CAS: | 125-31-5 | | MF: | C23H22O5S | | MW: | 410.48 | | EINECS: | 204-736-5 | | Product Categories: | Sulfonephthalein;Organics;Analytical Chemistry;Indicator (pH);pH Indicators | | Mol File: | 125-31-5.mol |  |
| | P-XYLENOL BLUE Chemical Properties |
| Melting point | 212°C (dec.) | | Boiling point | 577.2±50.0 °C(Predicted) | | density | 1.346±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | Solubility Slightly soluble in water, soluble in ethanol | | form | Powder | | pka | 9.52(at 25℃) | | color | Dark brown | | PH Range | 1.2(red)-2.8(yellow) 8(yellow)-9.6(blue) | | Odor | Odorless | | λmax | 424nm | | Merck | 14,10083 | | BRN | 363132 | | Major Application | Electrochromic displays, chemical sensors, fiber-optic pH sensors, optical quality films, ink, corrosion testing, lubricants, TTI indicators, food storage, cosmetics, bacterial growth, microbiological assays, determining lipase, drugs | | InChI | 1S/C23H22O5S/c1-13-11-20(24)15(3)9-18(13)23(19-10-16(4)21(25)12-14(19)2)17-7-5-6-8-22(17)29(26,27)28-23/h5-12,24-25H,1-4H3 | | InChIKey | MGUKYHHAGPFJMC-UHFFFAOYSA-N | | SMILES | Cc1cc(c(C)cc1O)C2(OS(=O)(=O)c3ccccc23)c4cc(C)c(O)cc4C | | CAS DataBase Reference | 125-31-5(CAS DataBase Reference) | | EPA Substance Registry System | Xylenol Blue (125-31-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | P-XYLENOL BLUE Usage And Synthesis |
| Chemical Properties | P-XYLENOL BLUE is Brown powder | | Uses | Indicator, used in 0.02% solution: pH 1.2 red, 2.8 yellow, 9.6 blue. | | Uses | Xylenol Blue is used in methods and devices that change color to indicate the presence of opioids and other narcotics. |
| | P-XYLENOL BLUE Preparation Products And Raw materials |
|