|
|
| | 2-(4-FLUOROBENZYLAMINO)ETHANOL Basic information | | Uses |
| Product Name: | 2-(4-FLUOROBENZYLAMINO)ETHANOL | | Synonyms: | CHEMBRDG-BB 4004526;2-(4-FLUOROBENZYLAMINO)ETHANOL;Ethanol-2-(4-(fluorophenyl)methyl)amine;2-(4-Fluorobenzyl)-Ethanolamino;Ethanol, 2-[[(4-fluorophenyl)Methyl]aMino]-;2-(4-FLUOROBENZYLAMINO)ETHANOL,98%;2-[(4-fluorobenzyl)amino]ethanol(SALTDATA: FREE);2-[(4-fluorophenyl)methylamino]ethanol | | CAS: | 22116-33-2 | | MF: | C9H12FNO | | MW: | 169.2 | | EINECS: | | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 22116-33-2.mol |  |
| | 2-(4-FLUOROBENZYLAMINO)ETHANOL Chemical Properties |
| Boiling point | 95-98 °C(Press: 3 Torr) | | density | 1.1358 g/cm3 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | pka | 14.75±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C9H12FNO/c10-9-3-1-8(2-4-9)7-11-5-6-12/h1-4,11-12H,5-7H2 | | InChIKey | KWEPMOQQKUYWIN-UHFFFAOYSA-N | | SMILES | C(O)CNCC1=CC=C(F)C=C1 | | CAS DataBase Reference | 22116-33-2(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | HazardClass | IRRITANT |
| | 2-(4-FLUOROBENZYLAMINO)ETHANOL Usage And Synthesis |
| Uses | 2-[(4-Fluorobenzyl)amino]ethanol is used in preparation of (Fluorobenzyl)aminomethylmorpholine salt and its application in preparation of mosapride citrate. | | Uses | 2-[(4-Fluorobenzyl)amino]ethanol is used in preparation of (Fluorobenzyl)aminomethylmorpholine salt and its application in preparation of mosapride citrate. | | Application | 2-(4-FLUOROBENZYLAMINO)ETHANOL can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | | Synthesis |  P-fluorobenzaldehyde (24.8 g, 0.2 mol) and 2-aminoethanol (15.3 g, 0.25 mol) were added to a reaction flask containing methanol (250 ml), heated to reflux, and kept at 65 C for 4 h.The temperature was lowered, sodium borohydride (9.2 g 0.24 mol) was added, and the reaction was stirred, the reaction was completed, filtered, and concentrated.The fraction was collected to give 2-(4-fluorobenzylamino)ethanol as a colorless oily liquid (yield: 90.2%, purity 98.7%). |
| | 2-(4-FLUOROBENZYLAMINO)ETHANOL Preparation Products And Raw materials |
|