|
|
| | 5-Methyl-3-phenylisoxazole-4-carbonyl chloride Basic information |
| Product Name: | 5-Methyl-3-phenylisoxazole-4-carbonyl chloride | | Synonyms: | 5-methyl-3-phenyl-1,2-oxazole-4-carbonylchloride;5-methyl-3-phenyl-4-isoxazolecarbonylchlorid;5-Methyl-3-phenyl-4-isoxazolecarbonylchloride;5-METHYL-3-PHENYLISOXAZOLE-4-CARBONYL CHLORIDE;5-METHYL-3-PHENYL-4-CHLOROCARBONYL ISOXAZOLE;5-Methyl-3-Phenyl-Isoxazol-4-Carboxylicacid Chloride;BUTTPARK 43\57-11;5-METHYL-3-PHENYL-4-CHLOROCARBONYLICISOXAZOLE ACID | | CAS: | 16883-16-2 | | MF: | C11H8ClNO2 | | MW: | 221.64 | | EINECS: | 240-915-4 | | Product Categories: | Oxazole&Isoxazole | | Mol File: | 16883-16-2.mol |  |
| | 5-Methyl-3-phenylisoxazole-4-carbonyl chloride Chemical Properties |
| Melting point | 24 °C | | Boiling point | 115-117 °C(Press: 3 Torr) | | density | 1.27 | | vapor pressure | 0.007Pa at 25℃ | | Fp | >100 | | solubility | soluble in Methanol | | form | powder to lump | | pka | -4.78±0.50(Predicted) | | color | White to Light yellow | | Water Solubility | 701.8mg/L at 25℃ | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C11H8ClNO2/c1-7-9(11(12)14)10(13-15-7)8-5-3-2-4-6-8/h2-6H,1H3 | | InChIKey | HXEVQMXCHCDPSO-UHFFFAOYSA-N | | SMILES | C(Cl)(C1=C(C)ON=C1C1=CC=CC=C1)=O | | LogP | 1.97 at 25℃ | | CAS DataBase Reference | 16883-16-2(CAS DataBase Reference) | | EPA Substance Registry System | 4-Isoxazolecarbonyl chloride, 5-methyl-3-phenyl- (16883-16-2) |
| Provider | Language |
|
ALFA
| English |
| | 5-Methyl-3-phenylisoxazole-4-carbonyl chloride Usage And Synthesis |
| Uses | Used as Intermediate of oxacillin sodium. | | Flammability and Explosibility | Not classified | | Synthesis | Benzaldehyde and hydroxylamine hydrochloride are oximeated under alkaline conditions to generate benzoxime, which is then chlorinated with chlorine to give benzoxime chloride. It is combined with ethyl acetoacetate to hydrolyze and chlorinated to obtain 5-Methyl-3-phenylisoxazole-4-carbonyl chloride. |
| | 5-Methyl-3-phenylisoxazole-4-carbonyl chloride Preparation Products And Raw materials |
|