- 2-naphthoic chloride
-
- $10.00/ kg
-
2024-04-23
- CAS:2243-83-6
- Min. Order: 1kg
- Purity: 99.7%
- Supply Ability: 200000kg
- 2-naphthoic chloride
-
- $8.00 / 1KG
-
2024-01-22
- CAS:2243-83-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 2-naphthoyl chloride
-
- $15.00 / 1kg
-
2024-01-08
- CAS:2243-83-6
- Min. Order: 1kg
- Purity: 99.80%
- Supply Ability: 20tons
|
| | 2-Naphthoyl chloride Basic information |
| | 2-Naphthoyl chloride Chemical Properties |
| Melting point | 50-52 °C (lit.) | | Boiling point | 160-162 °C/11 mmHg (lit.) | | density | 1.1664 (rough estimate) | | refractive index | 1.6530 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | Crystalline Chunks | | color | Gray to brown | | Sensitive | Moisture Sensitive | | BRN | 907776 | | InChI | InChI=1S/C11H7ClO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H | | InChIKey | XNLBCXGRQWUJLU-UHFFFAOYSA-N | | SMILES | C(Cl)(C1=CC=C2C(=C1)C=CC=C2)=O | | CAS DataBase Reference | 2243-83-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Naphthalenecarbonyl chloride(2243-83-6) | | EPA Substance Registry System | 2-Naphthalenecarbonyl chloride (2243-83-6) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163900 |
| | 2-Naphthoyl chloride Usage And Synthesis |
| Chemical Properties | White low melting solid | | Uses | 2-Naphthoyl chloride has been used in:
- preparation of amide derivatives of the amphetamine enantiomers
- synthesis of 7-dimethylamino-2-methyl-3-naphthamido-phenothiazinium salt
- modification of self-assembled monolayer formed on silica surface from ((((aminoethyl)amino)-methyl)phenethyl)trimethoxysilane
| | Uses | 2-Naphthoyl Chloride can be used for anticancer and antiinflammatory agents. |
| | 2-Naphthoyl chloride Preparation Products And Raw materials |
|