|
| 5-Bromo-2-hydroxynicotinic acid Basic information |
| 5-Bromo-2-hydroxynicotinic acid Chemical Properties |
Melting point | 287°C | Boiling point | 354.7±42.0 °C(Predicted) | density | 2.015±0.06 g/cm3(Predicted) | Fp | 287°C | storage temp. | Inert atmosphere,Room Temperature | form | powder to crystal | pka | 2.09±0.20(Predicted) | color | Light orange to Yellow to Green | Decomposition | 287 ºC | InChI | InChI=1S/C6H4BrNO3/c7-3-1-4(6(10)11)5(9)8-2-3/h1-2H,(H,8,9)(H,10,11) | InChIKey | GYXOTADLHQJPIP-UHFFFAOYSA-N | SMILES | C1(=O)NC=C(Br)C=C1C(O)=O | CAS DataBase Reference | 104612-36-4(CAS DataBase Reference) |
Hazard Codes | Xi | Hazard Note | Irritant/Keep Cold | HazardClass | IRRITANT | HS Code | 29333990 |
| 5-Bromo-2-hydroxynicotinic acid Usage And Synthesis |
| 5-Bromo-2-hydroxynicotinic acid Preparation Products And Raw materials |
|