2'AMINO-4'-METHOXYACETOPHENONE manufacturers
|
| 2'AMINO-4'-METHOXYACETOPHENONE Basic information |
Product Name: | 2'AMINO-4'-METHOXYACETOPHENONE | Synonyms: | 2-amino-4-methoxyphenylmethylketone;1-(2-aMino-4-Methoxyphenyl)ethan-1-one;1-(2-AMINO-4-METHOXYPHENYL)ETHANONE;Ethanone, 1-(2-amino-4-methoxyphenyl)-;2’-Amino-4’-methoxylacetophenone;2'AMINO-4'-METHOXYACETOPHENONE;2′-Amino-4′-methoxyacetophenone, CAS 42465-53-2;2'AMINO-4'-METHOXYACETOPHENONE | CAS: | 42465-53-2 | MF: | C9H11NO2 | MW: | 165.19 | EINECS: | | Product Categories: | | Mol File: | 42465-53-2.mol |  |
| 2'AMINO-4'-METHOXYACETOPHENONE Chemical Properties |
Melting point | 119-120 °C | Boiling point | 327.3±22.0 °C(Predicted) | density | 1.121±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | pka | 1.88±0.10(Predicted) | InChI | InChI=1S/C9H11NO2/c1-6(11)8-4-3-7(12-2)5-9(8)10/h3-5H,10H2,1-2H3 | InChIKey | FOFUOGSRVUOROJ-UHFFFAOYSA-N | SMILES | C(=O)(C1=CC=C(OC)C=C1N)C | CAS DataBase Reference | 42465-53-2(CAS DataBase Reference) |
| 2'AMINO-4'-METHOXYACETOPHENONE Usage And Synthesis |
Uses | 1-(2-Amino-4-methoxyphenyl)ethanone is a useful research reagent for the synthesis of benzothiazine derivatives with antiproliferative activity. |
| 2'AMINO-4'-METHOXYACETOPHENONE Preparation Products And Raw materials |
|