|
| 6-(BOC-AMINO)-HEXYL BROMIDE Basic information |
| 6-(BOC-AMINO)-HEXYL BROMIDE Chemical Properties |
Boiling point | 340.1±25.0 °C(Predicted) | density | 1.192 g/mL at 20 °C(lit.) | refractive index | n20/D 1.473 | storage temp. | Inert atmosphere,2-8°C | solubility | Chloroform (Sparingly), Ethyl Acetate (Sparingly), Methanol (Slightly) | pka | 12.91±0.46(Predicted) | form | liquid | color | Colourless to light yellow | InChI | InChI=1S/C11H22BrNO2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8-12/h4-9H2,1-3H3,(H,13,14) | InChIKey | NXQXVXILNVTMNA-UHFFFAOYSA-N | SMILES | C(OC(C)(C)C)(=O)NCCCCCCBr |
Hazard Codes | Xi,N | Risk Statements | 41-52/53 | Safety Statements | 26-39-61 | RIDADR | UN 3082 9/PG 3 | WGK Germany | 3 | F | 10-21 | HS Code | 2924190090 |
| 6-(BOC-AMINO)-HEXYL BROMIDE Usage And Synthesis |
Chemical Properties | 6-(BOC-AMINO)-HEXYL BROMIDE is Colourless Liquid | Uses | 6-(BOC-AMINO)-HEXYL BROMIDE is an intermediate used in the synthesis of fluorescent indicators and various inhibitors | reaction suitability | reagent type: cross-linking reagent | IC 50 | Non-cleavable Linker |
| 6-(BOC-AMINO)-HEXYL BROMIDE Preparation Products And Raw materials |
|