| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:1-(2-Pyridylcarbonyl)benzotriazole
CAS:144223-29-0
Remarks:SR01020044
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1-(2-Pyridylcarbonyl)benzotriazole
CAS:144223-29-0
Purity:97% Package:1G Remarks:631914-1G
|
|
| | 1-(2-PYRIDYLCARBONYL)BENZOTRIAZOLE 97 Basic information |
| | 1-(2-PYRIDYLCARBONYL)BENZOTRIAZOLE 97 Chemical Properties |
| Melting point | 117-124 °C (lit.) | | form | solid | | InChI | 1S/C12H8N4O/c17-12(10-6-3-4-8-13-10)16-11-7-2-1-5-9(11)14-15-16/h1-8H | | InChIKey | STCGMSMATDHRCO-UHFFFAOYSA-N | | SMILES | O=C(c1ccccn1)n2nnc3ccccc23 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-(2-PYRIDYLCARBONYL)BENZOTRIAZOLE 97 Usage And Synthesis |
| Uses | Reactant for:
- Preparation of ruthenium(II) benzotriazole triphenylphosphine pyridylcarboxylato chloro complex
- Preparation of acyl azides via reactions with sodium azide
- Acylation of Grignard and heteroaryllithium reagents
- Chemoselective reduction reactions
| | Synthesis Reference(s) | Tetrahedron, 48, p. 7817, 1992 DOI: 10.1016/S0040-4020(01)80459-2 | | reaction suitability | reaction type: C-C Bond Formation |
| | 1-(2-PYRIDYLCARBONYL)BENZOTRIAZOLE 97 Preparation Products And Raw materials |
|