| Company Name: |
Shandong Dongde New Materials Co., Ltd Gold
|
| Tel: |
13290191024 |
| Email: |
3887351301@qq.com |
| Products Intro: |
Product Name:6-Bromo-3-chloro-1,2,4-triazine
CAS:1260672-35-2
Purity:98% Package:1g;5g;25g
|
| Company Name: |
Mashilabs (Shanghai) Co.,Ltd.
|
| Tel: |
19916721580 |
| Email: |
mafarm@126.com |
| Products Intro: |
Product Name:6-Bromo-3-chloro-1,2,4-triazine
CAS:1260672-35-2
Purity:0.98
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
0519-85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:6-bromo-3-chloro-1,2,4-triazine
CAS:1260672-35-2
Purity:97+% Package:1g;5g
|
|
| | 1,2,4-Triazine, 6-bromo-3-chloro- Basic information |
| | 1,2,4-Triazine, 6-bromo-3-chloro- Chemical Properties |
| Boiling point | 324.8±34.0 °C(Predicted) | | density | 1.999±0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | -1.61±0.63(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C3HBrClN3/c4-2-1-6-3(5)8-7-2/h1H | | InChIKey | IIMYSUKDSQYYER-UHFFFAOYSA-N | | SMILES | N1C(Br)=CN=C(Cl)N=1 |
| | 1,2,4-Triazine, 6-bromo-3-chloro- Usage And Synthesis |
| | 1,2,4-Triazine, 6-bromo-3-chloro- Preparation Products And Raw materials |
|