|
|
| | S-2-Benzothiazolyl 2-amino-alpha-(methoxyimino)-4-thiazolethiolacetate Basic information |
| | S-2-Benzothiazolyl 2-amino-alpha-(methoxyimino)-4-thiazolethiolacetate Chemical Properties |
| Melting point | 128-130 °C(lit.) | | Boiling point | 563.2±42.0 °C(Predicted) | | density | 1.63 | | refractive index | 1.6200 (estimate) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 1.22±0.10(Predicted) | | color | Pale Yellow | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C13H10N4O2S3/c1-19-17-10(8-6-20-12(14)15-8)11(18)22-13-16-7-4-2-3-5-9(7)21-13/h2-6H,1H3,(H2,14,15)/b17-10- | | InChIKey | COFDRZLHVALCDU-YVLHZVERSA-N | | SMILES | S(C1SC2C=CC=CC=2N=1)C(=O)/C(/C1N=C(N)SC=1)=N\OC | | CAS DataBase Reference | 80756-85-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 2 | | RTECS | XJ4664500 | | HS Code | 2934.20.8000 |
| | S-2-Benzothiazolyl 2-amino-alpha-(methoxyimino)-4-thiazolethiolacetate Usage And Synthesis |
| Chemical Properties | S-2-Benzothiazolyl 2-amino-alpha-(methoxyimino)-4-thiazolethiolacetate is light yellow powder | | Uses | S-2-Benzothiazolyl 2-amino-alpha-(methoxyimino)-4-thiazolethiolacetate is used in the synthesis of Cefotaxime and related derivatives, such as: Ceftriaxone (C245000). | | Hazard | Low toxicity by ingestion. |
| | S-2-Benzothiazolyl 2-amino-alpha-(methoxyimino)-4-thiazolethiolacetate Preparation Products And Raw materials |
|