- L-3-Cyanophenylalanine
-
- $1.00 / 1KG
-
2019-08-02
- CAS:57213-48-6
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 500kg/month
|
| | L-3-Cyanophenylalanine Basic information |
| | L-3-Cyanophenylalanine Chemical Properties |
| Boiling point | 325.7°C (rough estimate) | | density | 1.2167 (rough estimate) | | refractive index | 1.6300 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 2.14±0.10(Predicted) | | form | Powder | | color | White to slightly yellow | | InChI | InChI=1S/C10H10N2O2/c11-6-8-3-1-2-7(4-8)5-9(12)10(13)14/h1-4,9H,5,12H2,(H,13,14)/t9-/m0/s1 | | InChIKey | ZHUOMTMPTNZOJE-VIFPVBQESA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC(C#N)=C1)N | | CAS DataBase Reference | 57213-48-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 26-37/39-37/38 | | RIDADR | UN3439 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29225090 |
| Provider | Language |
|
ACROS
| English |
| | L-3-Cyanophenylalanine Usage And Synthesis |
| Chemical Properties | white to slightly yellow powder | | Uses | H-Phe(3-CN)-OH is a phenylalanine derivative[1]. | | Antimicrobial activity | L-3-Cyanophenylalanine (3CP) is a β-amino acid that has been shown to
have an interaction with serine protease. 3CP is an antibacterial agent
that is used in the treatment of bacterial infections. It has been shown
to inhibit the growth of bacteria by inhibiting the acid transporter,
which leads to a decrease in intracellular pH. 3CP binds to the basic
group of the enzyme and forms a covalent bond, inhibiting its function.
The synthesis of 3CP can be achieved through synthetic chemistry or by
enzymatic conversion from L-serine. This compound can also be obtained
as an enantiomer, meaning it has two different forms: one that is active
and one that is inactive. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-828. DOI:10.1080/10408398.2012.708368 |
| | L-3-Cyanophenylalanine Preparation Products And Raw materials |
|