| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4'-(Trifluoromethoxy)acetophenone Basic information | | Uses |
| | 4'-(Trifluoromethoxy)acetophenone Chemical Properties |
| Boiling point | 100 °C | | density | 1.278 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | 190 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | Specific Gravity | 1.278 | | color | Yellow to light brown | | BRN | 5930486 | | InChI | 1S/C9H7F3O2/c1-6(13)7-2-4-8(5-3-7)14-9(10,11)12/h2-5H,1H3 | | InChIKey | MOEXTBIPPMLEFX-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(OC(F)(F)F)cc1 | | CAS DataBase Reference | 85013-98-5(CAS DataBase Reference) | | NIST Chemistry Reference | Ethanone, 1-[4-(trifluoromethoxy)phenyl]-(85013-98-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39-23-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29147000 | | Storage Class | 10 - Combustible liquids |
| | 4'-(Trifluoromethoxy)acetophenone Usage And Synthesis |
| Uses | 4-(trifluoromethoxy)acetophenone is a ketone derivative, and some literature reports that it can be used to prepare a metal complex for electroluminescent devices. | | Chemical Properties | clear yellow liquid | | Uses | 4′-(Trifluoromethoxy)acetophenone is an organic building block. It is also referred as p-(trifluoromethoxy)acetophenone. | | Synthesis Reference(s) | Journal of the American Chemical Society, 109, p. 3708, 1987 DOI: 10.1021/ja00246a030 | | General Description | 4′-(Trifluoromethoxy)acetophenone is an organic building block. It is also referred as p-(trifluoromethoxy)acetophenone. | | Synthesis | 4-(Trifluoromethoxy)acetophenone can be obtained from 4-trifluoromethoxybenzaldehyde as a raw material by reaction with Grignard's reagent. |
| | 4'-(Trifluoromethoxy)acetophenone Preparation Products And Raw materials |
|