|
|
| | 6-HYDROXYCAPROIC ACID Basic information |
| Product Name: | 6-HYDROXYCAPROIC ACID | | Synonyms: | 6-HYDROXYHEXANOIC ACID;6-HYDROXYCAPROIC ACID;6-Hydroxycaproic Acid,Contains Lactone;Hexanoic acid, 6-hydroxy-;6-Hydroxycaproicacid,pract.,containslactone;6-Hydroxycaproicacidmaycont.variableamountsofdimer;6-HYDROXYCAPROIC ACID, 95%, MAY CONT. VARIABLE AMOUNTS OF DI;6-Hydroxycaproic acid, 95%, may cont. variable amounts of dimer | | CAS: | 1191-25-9 | | MF: | C6H12O3 | | MW: | 132.16 | | EINECS: | | | Product Categories: | | | Mol File: | 1191-25-9.mol |  |
| | 6-HYDROXYCAPROIC ACID Chemical Properties |
| Melting point | 38-40 °C | | Boiling point | 113-116 °C | | density | 0.981 | | refractive index | 1.44 | | Fp | >110°C | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Low Melting Crystalline Solid | | pka | 4.75±0.10(Predicted) | | color | White | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9) | | InChIKey | IWHLYPDWHHPVAA-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCO | | LogP | -0.191 (est) |
| | 6-HYDROXYCAPROIC ACID Usage And Synthesis |
| Chemical Properties | white low melting crystalline solid | | Uses | 6-Hydroxyhexanoic acid acts as a useful reagent in synthetic chemistry. It is used as a precursor to prepare surface active monomers. | | Definition | ChEBI: 6-hydroxyhexanoic acid is an omega-hydroxy fatty acid comprising hexanoic acid having a hydroxy group at the 6-position. It has a role as a bacterial xenobiotic metabolite. It is a 6-hydroxy monocarboxylic acid, a straight-chain fatty acid and an omega-hydroxy-medium-chain fatty acid. It is functionally related to a hexanoic acid. It is a conjugate acid of a 6-hydroxyhexanoate. |
| | 6-HYDROXYCAPROIC ACID Preparation Products And Raw materials |
|