|
|
| | 2-Nitrophenol-3,4,5,6-d4 Basic information |
| Product Name: | 2-Nitrophenol-3,4,5,6-d4 | | Synonyms: | 2-NITROPHENOL (RING-D4);2-NITROPHENOL (D4);Phen-2,3,4,5-D4-ol, 6-nitro-;2-Nitrophenol-d4
DISCONTINUED PLEASE SEE N496906;2-Nitrophenol-3,4,5,6-d4;2-Nitrophenol-3,4,5,6-d4 in isopropanol;2-Nitrophenol-ring-D? (D, 98%);2-Nitrophenol-3,4,5,6-d4 | | CAS: | 93951-78-1 | | MF: | C6HD4NO3 | | MW: | 143.13 | | EINECS: | | | Product Categories: | Alphabetical Listings;N-O;Stable Isotopes | | Mol File: | 93951-78-1.mol |  |
| | 2-Nitrophenol-3,4,5,6-d4 Chemical Properties |
| Melting point | 43-45 °C(lit.) | | Fp | 102 °C | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Ethyl Acetate | | form | Solid | | color | Yellow | | InChI | 1S/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H/i1D,2D,3D,4D | | InChIKey | IQUPABOKLQSFBK-RHQRLBAQSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c(O)c1[2H])[N+]([O-])=O | | EPA Substance Registry System | Phen-2,3,4,5-d4-ol, 6-nitro- (93951-78-1) | | CAS Number Unlabeled | 88-75-5 |
| Hazard Codes | Xn | | Risk Statements | 22-52/53 | | Safety Statements | 26-36 | | RIDADR | UN 1663 6.1/PG 3 | | WGK Germany | 2 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | 2-Nitrophenol-3,4,5,6-d4 Usage And Synthesis |
| Uses | 2-Nitrophenol-3,4,5,6-d4 (CAS# 93951-78-1) is a useful isotopically labeled research compound. |
| | 2-Nitrophenol-3,4,5,6-d4 Preparation Products And Raw materials |
|