|
|
| | ENTEROLACTONE Basic information |
| Product Name: | ENTEROLACTONE | | Synonyms: | DIHYDRO-3,4-BIS(3-HYDROXYPHENYL)METHYL-2(3H)-FURANONE;HPMF;2(3H)-Furanone, dihydro-3,4-bis((3-hydroxyphenyl)methyl)-, (3R,4R)-rel-;2(3H)-Furanone, dihydro-3,4-bis((3-hydroxyphenyl)methyl)-, trans-;Ccris 3048;rac Enterolactone;(+/-)-TRANS-DIHYDRO-3, 4-BIS[(3-HYDROXYPHENYL)METHYL]-2(3H)-FURANONE;TRANS-ALPHA,BETA-BIS(3-HYDROXYBENZYL)BUTYROLACTONE | | CAS: | 78473-71-9 | | MF: | C18H18O4 | | MW: | 298.33 | | EINECS: | | | Product Categories: | Steroids;Apoptosis;Aromatics;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 78473-71-9.mol |  |
| | ENTEROLACTONE Chemical Properties |
| Melting point | 141-143° | | Boiling point | 561.4±25.0 °C(Predicted) | | density | 1.298±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.93±0.10(Predicted) | | color | Off-White to Grey | | BRN | 4699604 | | InChI | 1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2/t14-,17+/m1/s1 | | InChIKey | HVDGDHBAMCBBLR-PBHICJAKSA-N | | SMILES | Oc1cccc(C[C@@H]2COC(=O)[C@H]2Cc3cccc(O)c3)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | ENTEROLACTONE Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of sesame lignans (sesamin, sesamolin). Inhibits colonic cancer cell growth by inducing cell cycle arrest and apoptosis. Possible relationship between exposure and reduced risk of breast cancer. | | Biochem/physiol Actions | Enterolactone is the major human metabolite of dietary sesamin (lignan from sesame seeds). A phytoestrogen, it shows an inverse correlation with risk of breast cancer in one study. |
| | ENTEROLACTONE Preparation Products And Raw materials |
|