|
|
| | 3-(3-Trifluoromethylphenyl)propionic acid Basic information |
| | 3-(3-Trifluoromethylphenyl)propionic acid Chemical Properties |
| Melting point | 35°C(lit.) | | Boiling point | 149°C/11mmHg(lit.) | | density | 1.307±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.56±0.10(Predicted) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C10H9F3O2/c11-10(12,13)8-3-1-2-7(6-8)4-5-9(14)15/h1-3,6H,4-5H2,(H,14,15) | | InChIKey | YLTJJMIWCCJIHI-UHFFFAOYSA-N | | SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCC(=O)O | | CAS DataBase Reference | 585-50-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HS Code | 2916399090 |
| | 3-(3-Trifluoromethylphenyl)propionic acid Usage And Synthesis |
| Description | 3-(3-Trifluoromethylphenyl)propionic acid is an important organic solvent with a mild, pleasant aroma, used as an efficient organic reagent in polymer production processes and as a co-catalyst for trifluoroacetic acid. It is used in biological research as a substrate for the synthesis of various compounds and for the study of enzyme-catalysed reactions. It is also used in the synthesis of cinacalcet. Cinacalcet is a drug used to treat chronic kidney disease (dialysis) and high levels of calcium in the blood (parathyroid disease). | | Chemical Properties | 3-(3-Trifluoromethylphenyl)propionic acid has the appearance of a white or colourless to yellowish powder to a lumpy to clear liquid with a melting point of 35 °C and a boiling point of 149 °C/11 mmHg; store at room temperature. | | Uses | 3-(3-Trifluoromethylphenyl)propionic Acid can be used as catalysts. | | Uses | 3-(3-Trifluoromethylphenyl)propionic acid is used in the synthesis of Cinacalcet and also participates in the boron-catalyzed N-alkylation of amines of carboxylic acids. | | Preparation | 3-(3-Trifluoromethylphenyl)propionic acid is synthesised by the reaction of 3-trifluoromethylaniline and propionic acid. |
| | 3-(3-Trifluoromethylphenyl)propionic acid Preparation Products And Raw materials |
|