- 2-Chloromalonaldehyde
-
- $0.00 / 1kg
-
2023-11-01
- CAS:36437-19-1
- Min. Order: 0.10000000149011612kg
- Purity: 99.0%min
- Supply Ability: 5MT/month
- 2-Chloromalonaldehyde
-
- $1.00 / 1g
-
2020-01-10
- CAS:36437-19-1
- Min. Order: 1g
- Purity: Min98%HPLC
- Supply Ability: g/kg/ton
|
| | 2-CHLOROMALONALDEHYDE Basic information |
| Product Name: | 2-CHLOROMALONALDEHYDE | | Synonyms: | 2-CHLOROMALONALDEHYDE;2-CHLOROMALONALDEHYDE 95%;2-Chloromalonaldehyde,95%;2-Chloromalonaldehyde ,94%;2-Chloro-1,3-propanedial;Chloromalondialdehyde;Chloromalonic dialdehyde;2-cloroMalonaldehyde | | CAS: | 36437-19-1 | | MF: | C3H3ClO2 | | MW: | 106.51 | | EINECS: | | | Product Categories: | | | Mol File: | 36437-19-1.mol |  |
| | 2-CHLOROMALONALDEHYDE Chemical Properties |
| Melting point | 140-145 °C | | Boiling point | 111℃ | | density | 1.261 | | refractive index | 1.4100 (estimate) | | Fp | 32℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) | | pka | 1.48±0.10(Predicted) | | form | Crystalline Powder | | color | Brown | | InChI | InChI=1S/C3H3ClO2/c4-3(1-5)2-6/h1-3H | | InChIKey | KTRZQCIGJUWSGE-UHFFFAOYSA-N | | SMILES | C(=O)C(Cl)C=O |
| Provider | Language |
|
ACROS
| English |
| | 2-CHLOROMALONALDEHYDE Usage And Synthesis |
| Chemical Properties | BROWN CRYSTALLINE POWDER | | Uses | 2-Chloromalonaldehyde is used in the synthesis of novel heterocyclic acetyl coenzyme-A carboxylase inhibitors. Also used in the production of aldose reductase inhibitors used in the treatment of diabetes mellitus. |
| | 2-CHLOROMALONALDEHYDE Preparation Products And Raw materials |
|