4-Chloro-5-methoxypyrimidin-2-amine manufacturers
|
| | 4-Chloro-5-methoxypyrimidin-2-amine Basic information |
| Product Name: | 4-Chloro-5-methoxypyrimidin-2-amine | | Synonyms: | 4-CHLORO-5-METHOXYPYRIMIDIN-2-AMINE;2-AMino-4-chloro-5-Methoxy-pyriMidine;2-Pyrimidinamine, 4-chloro-5-methoxy-;4-CHLORO-5-METHOXYPYRIMIDIN-2-AMINE ISO 9001：2015 REACH | | CAS: | 4763-36-4 | | MF: | C5H6ClN3O | | MW: | 159.57 | | EINECS: | | | Product Categories: | | | Mol File: | 4763-36-4.mol |  |
| | 4-Chloro-5-methoxypyrimidin-2-amine Chemical Properties |
| Melting point | 146-148 °C(Solv: water, 20% (7732-18-5); acetic acid (64-19-7); ethanol (64-17-5)) | | Boiling point | 345.3±45.0 °C(Predicted) | | density | 1.398±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 3.41±0.10(Predicted) | | InChI | InChI=1S/C5H6ClN3O/c1-10-3-2-8-5(7)9-4(3)6/h2H,1H3,(H2,7,8,9) | | InChIKey | OXAYXWLBMCQAJC-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(OC)C(Cl)=N1 |
| | 4-Chloro-5-methoxypyrimidin-2-amine Usage And Synthesis |
| Uses | 4-Chloro-5-methoxypyrimidin-2-amine is a pyrimidine derivative used as a pharmaceutical intermediate for pharmaceutical synthesis and scientific research. |
| | 4-Chloro-5-methoxypyrimidin-2-amine Preparation Products And Raw materials |
|