| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 18918157536; |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dihydroxyacetonedimer Basic information |
| Product Name: | Dihydroxyacetonedimer | | Synonyms: | 3,6-bis(hydroxyMethyl)-1,4-dioxane-2,5-diol;DL-Glyceraldehyde, dimer 95%;NSC 72202;DL-Glyceraldehyde (Dimer), 95.0%+;DL-Glyceraldehyde (Dimer) 93+%;1,4-Dioxane-2,5-dimethanol, 3,6-dihydroxy-;DL-Glyceraldehyde, dimer;DL-Glyceraldehyde, dimer 95% | | CAS: | 23147-59-3 | | MF: | C6H12O6 | | MW: | 180.16 | | EINECS: | | | Product Categories: | | | Mol File: | 23147-59-3.mol |  |
| | Dihydroxyacetonedimer Chemical Properties |
| Melting point | 144-145°C (lit.) | | Boiling point | 469.3±45.0 °C(Predicted) | | density | 1.505±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.60±0.70(Predicted) | | form | crystalline powder | | color | White | | InChI | 1S/2C3H6O3/c2*4-1-3(6)2-5/h2*1,3,5-6H,2H2 | | InChIKey | NGNVWCSFFIVLAR-UHFFFAOYSA-N | | SMILES | OC[C@H]1O[C@@H](O)[C@H](CO)O[C@@H]1O |
| WGK Germany | 3 | | HS Code | 29124900 | | Storage Class | 11 - Combustible Solids |
| | Dihydroxyacetonedimer Usage And Synthesis |
| Uses | - Aldehyde Reductase Activity: The enzymatic properties of DL-Glyceraldehyde dimer were examined in the context of aldehyde reductases from Euonymus japonica leaves, providing insights into the reduction processes of aldose sugars, which are significant for understanding stress responses in plants (Negm, 1986).
- Enzymatic Reductase Functions: DL-Glyceraldehyde dimer was studied in the purification and characterization of human liver aldehyde reductases, focusing on its role in metabolic detoxification, crucial for pharmaceutical applications involving drug metabolism and toxicity (Petrash and Srivastava, 1982).
- Protozoan Metabolic Pathways: The enzymatic characterization of aldehyde reductase from Crithidia fasciculata, with DL-Glyceraldehyde dimer as a substrate, provided insights into the metabolic pathways of protozoans, important for developing treatments against parasitic infections (Kobayashi, 1982).
|
| | Dihydroxyacetonedimer Preparation Products And Raw materials |
|