|
|
| | (S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol Basic information |
| Product Name: | (S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol | | Synonyms: | (S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol;(+)-(S)-Epinephrine;(S)-Adrenaline;(S)-Epinephrine;1,2-Benzenediol, 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]-;1,2-Benzenediol, 4-[1-hydroxy-2-(methylamino)ethyl]-, (S)-;Benzyl alcohol, 3,4-dihydroxy-α-[(methylamino)methyl]-, (+)- (8CI);(+)-4-[(S)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol | | CAS: | 150-05-0 | | MF: | C9H13NO3 | | MW: | 183.2 | | EINECS: | 205-752-5 | | Product Categories: | | | Mol File: | 150-05-0.mol | ![(S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol Structure](CAS/GIF/150-05-0.gif) |
| | (S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol Chemical Properties |
| Melting point | 211.5°C | | Boiling point | 316.88°C (rough estimate) | | density | 1.1967 (rough estimate) | | refractive index | 1.4760 (estimate) | | solubility | Aqueous Acid (Slightly), DMSO (Slightly) | | form | Solid | | pka | 9.60±0.10(Predicted) | | color | Off-White to Light Brown | | InChI | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m1/s1 | | InChIKey | UCTWMZQNUQWSLP-SECBINFHSA-N | | SMILES | C1(O)=CC=C([C@H](O)CNC)C=C1O |
| | (S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol Usage And Synthesis |
| Uses | D-(+)-Epinephrine is a stereoisomer of Epinephrine, a natural neurotransmitter that is released from the adrenal medulla and activates adrenoceptors. | | Definition | ChEBI: (S)-adrenaline is the S-enantiomer of adrenaline. It is an enantiomer of a (R)-adrenaline. |
| | (S)-4-[1-hydroxy-2-(methylamino)ethyl]pyrocatechol Preparation Products And Raw materials |
|