| Company Name: |
Alfa Chemistry Gold
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:4-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]butyric acid, compound with cyclohexylamine (1:1)
CAS:84560-02-1
Purity:95%+ Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Shanghai Synmedia Chemical Co., Ltd.
|
| Tel: |
021-38681880 13817889927 |
| Email: |
sales@synmedia-chem.com |
| Products Intro: |
Product Name:4-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]butyric acid,compound with cyclohexylamine(1:1)
CAS:84560-02-1
Purity:98%min Package:1g, 5g, 25g, 100g, 1kg, 25kg
|
| Company Name: |
Guangzhou Isun Pharmaceutical Co., Ltd
|
| Tel: |
020-39119399 18927568969 |
| Email: |
isunpharm@qq.com |
| Products Intro: |
Product Name:Dansyl-γ-aMino-n-butyric acid cyclohexylaMMoniuM salt
CAS:84560-02-1
Purity:>=98.0% Package:25Mg; 1g; 100g; 500g
|
|
| | 4-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]butyric acid, compound with cyclohexylamine (1:1) Basic information |
| | 4-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]butyric acid, compound with cyclohexylamine (1:1) Chemical Properties |
| storage temp. | −20°C | | InChI | InChI=1S/C16H20N2O4S.C6H13N/c1-18(2)14-8-3-7-13-12(14)6-4-9-15(13)23(21,22)17-11-5-10-16(19)20;7-6-4-2-1-3-5-6/h3-4,6-9,17H,5,10-11H2,1-2H3,(H,19,20);6H,1-5,7H2 | | InChIKey | AEYRCAMGXZZOLB-UHFFFAOYSA-N | | SMILES | NC1CCCCC1.S(C1=CC=CC2=C(C=CC=C12)N(C)C)(=O)(=O)NCCCC(=O)O |
| | 4-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]butyric acid, compound with cyclohexylamine (1:1) Usage And Synthesis |
| | 4-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]butyric acid, compound with cyclohexylamine (1:1) Preparation Products And Raw materials |
|